Products 1007113-04-3
CAS 1007113-04-3 appears in our catalog under these names: 5–Fluoro–3–methoxy–2–nitrobenzoic acid, 5-Fluoro-3-methoxy-2-nitrobenzoic acid 95%, 5-Fluoro-3-methoxy-2-nitrobenzoic acid, 97%, 5-Fluoro-3-methoxy-2-nitrobenzoic acid, 97%, 97%. Offered by: GLPBio, Ambeed, Fluorochem, Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g, 25g.
5-fluoro-3-methoxy-2-nitrobenzoic acid (CAS 1007113-04-3) is a chemical compound with the molecular formula C8H6FNO5 and a molecular weight of 215.13 g/mol. IUPAC name: 5-fluoro-3-methoxy-2-nitrobenzoic acid. InChIKey: JKBWWRZRHVTZAW-UHFFFAOYSA-N.
| Molecular formula | C8H6FNO5 |
|---|---|
| Molecular weight | 215.13 g/mol |
| IUPAC name | 5-fluoro-3-methoxy-2-nitrobenzoic acid |
| InChIKey | JKBWWRZRHVTZAW-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1[N+](=O)[O-])C(=O)O)F |
Computed by PubChem (NCBI)