CAS 1007387-12-3 is the registry number for 6–broMo–4H–furo(3,2–b)pyrrole–5–carboxylic acid. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
6-bromo-4H-furo[3,2-b]pyrrole-5-carboxylic acid (CAS 1007387-12-3) is a chemical compound with the molecular formula C7H4BrNO3 and a molecular weight of 230.02 g/mol. IUPAC name: 6-bromo-4H-furo[3,2-b]pyrrole-5-carboxylic acid. InChIKey: OVIQOPYSEFRDMV-UHFFFAOYSA-N.
| Molecular formula | C7H4BrNO3 |
|---|---|
| Molecular weight | 230.02 g/mol |
| IUPAC name | 6-bromo-4H-furo[3,2-b]pyrrole-5-carboxylic acid |
| InChIKey | OVIQOPYSEFRDMV-UHFFFAOYSA-N |
| SMILES | C1=COC2=C1NC(=C2Br)C(=O)O |
Computed by PubChem (NCBI)