Products 1007387-96-3
CAS 1007387-96-3 is the registry number for Ethyl 4-Chloro-6H-thieno[2,3-b]pyrrole-5-carboxylate, >97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Ethyl 4-chloro-6H-thieno[2,3-b]pyrrole-5-carboxylate (CAS 1007387-96-3) is a chemical compound with the molecular formula C9H8ClNO2S and a molecular weight of 229.68 g/mol. IUPAC name: ethyl 4-chloro-6H-thieno[2,3-b]pyrrole-5-carboxylate. InChIKey: UMMMPHUCNBOYFZ-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO2S |
|---|---|
| Molecular weight | 229.68 g/mol |
| IUPAC name | ethyl 4-chloro-6H-thieno[2,3-b]pyrrole-5-carboxylate |
| InChIKey | UMMMPHUCNBOYFZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C2=C(N1)SC=C2)Cl |
Computed by PubChem (NCBI)