CAS 1052541-68-0 appears in our catalog under these names: 5-Amino-1-benzothiophene-2-carboxylic acid hydrochloride, 95%, 5-Amino-1-benzothiophene-2-carboxylic acid hydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg.
5-amino-1-benzothiophene-2-carboxylic acid;hydrochloride (CAS 1052541-68-0) is a chemical compound with the molecular formula C9H8ClNO2S and a molecular weight of 229.68 g/mol. IUPAC name: 5-amino-1-benzothiophene-2-carboxylic acid;hydrochloride. InChIKey: LAFLLFDXERPYQX-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO2S |
|---|---|
| Molecular weight | 229.68 g/mol |
| IUPAC name | 5-amino-1-benzothiophene-2-carboxylic acid;hydrochloride |
| InChIKey | LAFLLFDXERPYQX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1N)C=C(S2)C(=O)O.Cl |
Computed by PubChem (NCBI)