CAS 876316-36-8 appears in our catalog under these names: 1-Methyl-1h-indole-4-sulfonyl chloride, 95%, 1–Methyl–1H–indole–4–sulfonyl chloride, 1-Methyl-1H-indole-4-sulphonyl chloride, 1-Methyl-1H-indole-4-sulfonyl chloride, 97% , 1-Methyl-1H-indole-4-sulfonyl chloride 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Thermo Scientific, Ambeed. Available pack sizes: 250mg, 5g, 1g, 100mg, 2,5g, 10g, 500mg, 25g.
1-methylindole-4-sulfonyl chloride (CAS 876316-36-8) is a chemical compound with the molecular formula C9H8ClNO2S and a molecular weight of 229.68 g/mol. IUPAC name: 1-methylindole-4-sulfonyl chloride. InChIKey: HFWFOJFQXZBLAU-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO2S |
|---|---|
| Molecular weight | 229.68 g/mol |
| IUPAC name | 1-methylindole-4-sulfonyl chloride |
| InChIKey | HFWFOJFQXZBLAU-UHFFFAOYSA-N |
| SMILES | CN1C=CC2=C1C=CC=C2S(=O)(=O)Cl |
Computed by PubChem (NCBI)