CAS 941716-95-6 appears in our catalog under these names: 1-Methyl-1h-indole-7-sulfonyl chloride, 95%, 1-Methyl-1H-indole-7-sulfonyl chloride, 1-Methyl-1H-indole-7-sulfonyl chloride, 97% . Offered by: Combi-blocks, Biosynth, Thermo Scientific. Available pack sizes: 1g, 250mg, 0,5g, 5g.
1-methylindole-7-sulfonyl chloride (CAS 941716-95-6) is a chemical compound with the molecular formula C9H8ClNO2S and a molecular weight of 229.68 g/mol. IUPAC name: 1-methylindole-7-sulfonyl chloride. InChIKey: DVEZDWQOMVECCI-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO2S |
|---|---|
| Molecular weight | 229.68 g/mol |
| IUPAC name | 1-methylindole-7-sulfonyl chloride |
| InChIKey | DVEZDWQOMVECCI-UHFFFAOYSA-N |
| SMILES | CN1C=CC2=C1C(=CC=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)