CAS 1367937-31-2 is the registry number for 6-Methyl-1H-indole-3-sulfonyl chloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6-methyl-1H-indole-3-sulfonyl chloride (CAS 1367937-31-2) is a chemical compound with the molecular formula C9H8ClNO2S and a molecular weight of 229.68 g/mol. IUPAC name: 6-methyl-1H-indole-3-sulfonyl chloride. InChIKey: UPRMNRYTUACHOG-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO2S |
|---|---|
| Molecular weight | 229.68 g/mol |
| IUPAC name | 6-methyl-1H-indole-3-sulfonyl chloride |
| InChIKey | UPRMNRYTUACHOG-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(=CN2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)