Products 155048-06-9

CAS 155048-06-9 is the registry number for Butein Tetramethyl Ether. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 100mg, 1g, 500mg, 1 g, 100 mg.

Structural formula: {0} (CAS {1})

(E)-1-(2,4-dimethoxyphenyl)-3-(3,4-dimethoxyphenyl)prop-2-en-1-one (CAS 155048-06-9) is a chemical compound with the molecular formula C19H20O5 and a molecular weight of 328.4 g/mol. IUPAC name: (E)-1-(2,4-dimethoxyphenyl)-3-(3,4-dimethoxyphenyl)prop-2-en-1-one. InChIKey: XKVLLUWABVOODQ-WEVVVXLNSA-N.

Identity
Molecular formulaC19H20O5
Molecular weight328.4 g/mol
IUPAC name(E)-1-(2,4-dimethoxyphenyl)-3-(3,4-dimethoxyphenyl)prop-2-en-1-one
InChIKeyXKVLLUWABVOODQ-WEVVVXLNSA-N
SMILESCOC1=CC(=C(C=C1)C(=O)/C=C/C2=CC(=C(C=C2)OC)OC)OC

Computed by PubChem (NCBI)