Products 1007568-39-9
CAS 1007568-39-9 appears in our catalog under these names: Dimethyl 2-nitro-[1,1'-biphenyl]-4,4'-dicarboxylate 97%, Dimethyl 2-nitro-[1,1'-biphenyl]-4,4'-dicarboxylate, 97%, 97%. Offered by: Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 10g.
Methyl 4-(4-methoxycarbonylphenyl)-3-nitrobenzoate (CAS 1007568-39-9) is a chemical compound with the molecular formula C16H13NO6 and a molecular weight of 315.28 g/mol. IUPAC name: methyl 4-(4-methoxycarbonylphenyl)-3-nitrobenzoate. InChIKey: KEUDQEINBQSPKI-UHFFFAOYSA-N.
| Molecular formula | C16H13NO6 |
|---|---|
| Molecular weight | 315.28 g/mol |
| IUPAC name | methyl 4-(4-methoxycarbonylphenyl)-3-nitrobenzoate |
| InChIKey | KEUDQEINBQSPKI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)C2=C(C=C(C=C2)C(=O)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)