Products 1309853-81-3
CAS 1309853-81-3 appears in our catalog under these names: 5-((4-CARBOXYBENZYL)AMINO)ISOPHTHALIC ACID, 95%, 95%, 5-(4-Carboxybenzylamino)isophthalic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
5-[(4-carboxyphenyl)methylamino]benzene-1,3-dicarboxylic acid (CAS 1309853-81-3) is a chemical compound with the molecular formula C16H13NO6 and a molecular weight of 315.28 g/mol. IUPAC name: 5-[(4-carboxyphenyl)methylamino]benzene-1,3-dicarboxylic acid. InChIKey: BGGOIIRKSRFSIL-UHFFFAOYSA-N.
| Molecular formula | C16H13NO6 |
|---|---|
| Molecular weight | 315.28 g/mol |
| IUPAC name | 5-[(4-carboxyphenyl)methylamino]benzene-1,3-dicarboxylic acid |
| InChIKey | BGGOIIRKSRFSIL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CNC2=CC(=CC(=C2)C(=O)O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)