CAS 1007778-60-0 is the registry number for 2-(((7-Chlorobenzo[d][1,3]dioxol-5-yl)methyl)thio)propanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(7-chloro-1,3-benzodioxol-5-yl)methylsulfanyl]propanoic acid (CAS 1007778-60-0) is a chemical compound with the molecular formula C11H11ClO4S and a molecular weight of 274.72 g/mol. IUPAC name: 2-[(7-chloro-1,3-benzodioxol-5-yl)methylsulfanyl]propanoic acid. InChIKey: RYWAGMDXMWIZKH-UHFFFAOYSA-N.
| Molecular formula | C11H11ClO4S |
|---|---|
| Molecular weight | 274.72 g/mol |
| IUPAC name | 2-[(7-chloro-1,3-benzodioxol-5-yl)methylsulfanyl]propanoic acid |
| InChIKey | RYWAGMDXMWIZKH-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)SCC1=CC2=C(C(=C1)Cl)OCO2 |
Computed by PubChem (NCBI)