Products 1007778-60-0

CAS 1007778-60-0 is the registry number for 2-(((7-Chlorobenzo[d][1,3]dioxol-5-yl)methyl)thio)propanoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[(7-chloro-1,3-benzodioxol-5-yl)methylsulfanyl]propanoic acid (CAS 1007778-60-0) is a chemical compound with the molecular formula C11H11ClO4S and a molecular weight of 274.72 g/mol. IUPAC name: 2-[(7-chloro-1,3-benzodioxol-5-yl)methylsulfanyl]propanoic acid. InChIKey: RYWAGMDXMWIZKH-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11ClO4S
Molecular weight274.72 g/mol
IUPAC name2-[(7-chloro-1,3-benzodioxol-5-yl)methylsulfanyl]propanoic acid
InChIKeyRYWAGMDXMWIZKH-UHFFFAOYSA-N
SMILESCC(C(=O)O)SCC1=CC2=C(C(=C1)Cl)OCO2

Computed by PubChem (NCBI)