CAS 600134-92-7 appears in our catalog under these names: Methyl 1-(4-(chlorosulfonyl)phenyl)cyclopropane-1-carboxylate, 97%, Methyl 1-(4-(chlorosulfonyl)phenyl)cyclopropane-1-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Methyl 1-(4-chlorosulfonylphenyl)cyclopropane-1-carboxylate (CAS 600134-92-7) is a chemical compound with the molecular formula C11H11ClO4S and a molecular weight of 274.72 g/mol. IUPAC name: methyl 1-(4-chlorosulfonylphenyl)cyclopropane-1-carboxylate. InChIKey: ZQDRVUUGONDOGQ-UHFFFAOYSA-N.
| Molecular formula | C11H11ClO4S |
|---|---|
| Molecular weight | 274.72 g/mol |
| IUPAC name | methyl 1-(4-chlorosulfonylphenyl)cyclopropane-1-carboxylate |
| InChIKey | ZQDRVUUGONDOGQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(CC1)C2=CC=C(C=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)