CAS 2375269-01-3 is the registry number for Methyl 4-((chlorosulfonyl)methyl)cubane-1-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g, 100mg.
Methyl 4-(chlorosulfonylmethyl)cubane-1-carboxylate (CAS 2375269-01-3) is a chemical compound with the molecular formula C11H11ClO4S and a molecular weight of 274.72 g/mol. IUPAC name: methyl 4-(chlorosulfonylmethyl)cubane-1-carboxylate. InChIKey: RORXIBQCOHFONF-UHFFFAOYSA-N.
| Molecular formula | C11H11ClO4S |
|---|---|
| Molecular weight | 274.72 g/mol |
| IUPAC name | methyl 4-(chlorosulfonylmethyl)cubane-1-carboxylate |
| InChIKey | RORXIBQCOHFONF-UHFFFAOYSA-N |
| SMILES | COC(=O)C12C3C4C1C5C2C3C45CS(=O)(=O)Cl |
Computed by PubChem (NCBI)