CAS 926202-14-4 is the registry number for 4-(Chlorosulfonyl)-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-chlorosulfonyl-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid (CAS 926202-14-4) is a chemical compound with the molecular formula C11H11ClO4S and a molecular weight of 274.72 g/mol. IUPAC name: 4-chlorosulfonyl-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid. InChIKey: FZPRSOYKFSNRSK-UHFFFAOYSA-N.
| Molecular formula | C11H11ClO4S |
|---|---|
| Molecular weight | 274.72 g/mol |
| IUPAC name | 4-chlorosulfonyl-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid |
| InChIKey | FZPRSOYKFSNRSK-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C=C(C=C2S(=O)(=O)Cl)C(=O)O |
Computed by PubChem (NCBI)