CAS 879361-76-9 is the registry number for 1-(4-Chlorobenzenesulfonyl)cyclobutane-1-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
1-(4-chlorophenyl)sulfonylcyclobutane-1-carboxylic acid (CAS 879361-76-9) is a chemical compound with the molecular formula C11H11ClO4S and a molecular weight of 274.72 g/mol. IUPAC name: 1-(4-chlorophenyl)sulfonylcyclobutane-1-carboxylic acid. InChIKey: OTNJJMRXPYYIIS-UHFFFAOYSA-N.
| Molecular formula | C11H11ClO4S |
|---|---|
| Molecular weight | 274.72 g/mol |
| IUPAC name | 1-(4-chlorophenyl)sulfonylcyclobutane-1-carboxylic acid |
| InChIKey | OTNJJMRXPYYIIS-UHFFFAOYSA-N |
| SMILES | C1CC(C1)(C(=O)O)S(=O)(=O)C2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)