Products 1008-07-7
CAS 1008-07-7 appears in our catalog under these names: 7–chloro–3–formylindole, 7-Chloro-3-formylindole, 97%, 7-Chloro-1H-indole-3-carbaldehyde 98%, 7-Chloro-1H-Indole-3-Carbaldehyde, 97%, 97%. Offered by: GLPBio, Fluorochem, Ambeed, Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g.
7-chloro-1H-indole-3-carbaldehyde (CAS 1008-07-7) is a chemical compound with the molecular formula C9H6ClNO and a molecular weight of 179.60 g/mol. IUPAC name: 7-chloro-1H-indole-3-carbaldehyde. InChIKey: NHJNOJSRXQVQRT-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO |
|---|---|
| Molecular weight | 179.60 g/mol |
| IUPAC name | 7-chloro-1H-indole-3-carbaldehyde |
| InChIKey | NHJNOJSRXQVQRT-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)NC=C2C=O |
Computed by PubChem (NCBI)