Products 1008023-63-9
CAS 1008023-63-9 is the registry number for 5-Oxo-hexahydropyrrolo(2,1-b)(1,3)thiazole-3,7a-dicarboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3,7a-dicarboxylic acid (CAS 1008023-63-9) is a chemical compound with the molecular formula C8H9NO5S and a molecular weight of 231.23 g/mol. IUPAC name: 5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3,7a-dicarboxylic acid. InChIKey: GGRNQYLYTAMESX-UHFFFAOYSA-N.
| Molecular formula | C8H9NO5S |
|---|---|
| Molecular weight | 231.23 g/mol |
| IUPAC name | 5-oxo-2,3,6,7-tetrahydropyrrolo[2,1-b][1,3]thiazole-3,7a-dicarboxylic acid |
| InChIKey | GGRNQYLYTAMESX-UHFFFAOYSA-N |
| SMILES | C1CC2(N(C1=O)C(CS2)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)