Products 1008050-74-5
CAS 1008050-74-5 appears in our catalog under these names: 2-(2-Fluorobenzenesulfonamido)propanoic acid, 95%, 2–(2–Fluorobenzenesulfonamido)propanoic acid, ((2-Fluorophenyl)sulfonyl)alanine. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 5g, 10g, 1g, 250mg, 100mg, 2,5g.
2-[(2-fluorophenyl)sulfonylamino]propanoic acid (CAS 1008050-74-5) is a chemical compound with the molecular formula C9H10FNO4S and a molecular weight of 247.25 g/mol. IUPAC name: 2-[(2-fluorophenyl)sulfonylamino]propanoic acid. InChIKey: XEWYRRHRYVLKKL-UHFFFAOYSA-N.
| Molecular formula | C9H10FNO4S |
|---|---|
| Molecular weight | 247.25 g/mol |
| IUPAC name | 2-[(2-fluorophenyl)sulfonylamino]propanoic acid |
| InChIKey | XEWYRRHRYVLKKL-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)NS(=O)(=O)C1=CC=CC=C1F |
Computed by PubChem (NCBI)