Products 613657-21-9
CAS 613657-21-9 appears in our catalog under these names: 3-(2-Fluoro-benzenesulfonylamino)-propionic acid, 95%, 3-(2-Fluorobenzenesulfonamido)propanoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 5g, 250mg.
3-[(2-fluorophenyl)sulfonylamino]propanoic acid (CAS 613657-21-9) is a chemical compound with the molecular formula C9H10FNO4S and a molecular weight of 247.25 g/mol. IUPAC name: 3-[(2-fluorophenyl)sulfonylamino]propanoic acid. InChIKey: IHHDUPWVGVAAMD-UHFFFAOYSA-N.
| Molecular formula | C9H10FNO4S |
|---|---|
| Molecular weight | 247.25 g/mol |
| IUPAC name | 3-[(2-fluorophenyl)sulfonylamino]propanoic acid |
| InChIKey | IHHDUPWVGVAAMD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)F)S(=O)(=O)NCCC(=O)O |
Computed by PubChem (NCBI)