Products 1426892-19-4
CAS 1426892-19-4 is the registry number for Ethyl 2-fluoro-2-(pyridin-2-ylsulfonyl)acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-fluoro-2-pyridin-2-ylsulfonylacetate (CAS 1426892-19-4) is a chemical compound with the molecular formula C9H10FNO4S and a molecular weight of 247.25 g/mol. IUPAC name: ethyl 2-fluoro-2-pyridin-2-ylsulfonylacetate. InChIKey: WYVYUUHLNYHAPF-UHFFFAOYSA-N.
| Molecular formula | C9H10FNO4S |
|---|---|
| Molecular weight | 247.25 g/mol |
| IUPAC name | ethyl 2-fluoro-2-pyridin-2-ylsulfonylacetate |
| InChIKey | WYVYUUHLNYHAPF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(F)S(=O)(=O)C1=CC=CC=N1 |
Computed by PubChem (NCBI)