Products 392313-57-4

CAS 392313-57-4 is the registry number for N-(4-Fluorophenyl)-n-(methylsulfonyl)glycine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(4-fluoro-N-methylsulfonylanilino)acetic acid (CAS 392313-57-4) is a chemical compound with the molecular formula C9H10FNO4S and a molecular weight of 247.25 g/mol. IUPAC name: 2-(4-fluoro-N-methylsulfonylanilino)acetic acid. InChIKey: QXTAWUQQXRUPAP-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10FNO4S
Molecular weight247.25 g/mol
IUPAC name2-(4-fluoro-N-methylsulfonylanilino)acetic acid
InChIKeyQXTAWUQQXRUPAP-UHFFFAOYSA-N
SMILESCS(=O)(=O)N(CC(=O)O)C1=CC=C(C=C1)F

Computed by PubChem (NCBI)