CAS 363162-67-8 appears in our catalog under these names: [(2-Fluoro-phenyl)-methanesulfonyl-amino]-acetic acid, 95%, N-(2-Fluorophenyl)-N-(methylsulfonyl) glycine, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-(2-fluoro-N-methylsulfonylanilino)acetic acid (CAS 363162-67-8) is a chemical compound with the molecular formula C9H10FNO4S and a molecular weight of 247.25 g/mol. IUPAC name: 2-(2-fluoro-N-methylsulfonylanilino)acetic acid. InChIKey: HSTNUHGEHQNAEP-UHFFFAOYSA-N.
| Molecular formula | C9H10FNO4S |
|---|---|
| Molecular weight | 247.25 g/mol |
| IUPAC name | 2-(2-fluoro-N-methylsulfonylanilino)acetic acid |
| InChIKey | HSTNUHGEHQNAEP-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)N(CC(=O)O)C1=CC=CC=C1F |
Computed by PubChem (NCBI)