Products 1008428-30-5
CAS 1008428-30-5 is the registry number for 5-(2-Thienyl)-1h-pyrazole-4-carbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
5-thiophen-2-yl-1H-pyrazole-4-carbonitrile (CAS 1008428-30-5) is a chemical compound with the molecular formula C8H5N3S and a molecular weight of 175.21 g/mol. IUPAC name: 5-thiophen-2-yl-1H-pyrazole-4-carbonitrile. InChIKey: IWLPDQDSYGOVBI-UHFFFAOYSA-N.
| Molecular formula | C8H5N3S |
|---|---|
| Molecular weight | 175.21 g/mol |
| IUPAC name | 5-thiophen-2-yl-1H-pyrazole-4-carbonitrile |
| InChIKey | IWLPDQDSYGOVBI-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=C(C=NN2)C#N |
Computed by PubChem (NCBI)