CAS 2629318-66-5 is the registry number for 6-Aminobenzo[d]thiazole-7-carbonitrile, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
6-amino-1,3-benzothiazole-7-carbonitrile (CAS 2629318-66-5) is a chemical compound with the molecular formula C8H5N3S and a molecular weight of 175.21 g/mol. IUPAC name: 6-amino-1,3-benzothiazole-7-carbonitrile. InChIKey: QEMNKQSSPKQUHL-UHFFFAOYSA-N.
| Molecular formula | C8H5N3S |
|---|---|
| Molecular weight | 175.21 g/mol |
| IUPAC name | 6-amino-1,3-benzothiazole-7-carbonitrile |
| InChIKey | QEMNKQSSPKQUHL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1N)C#N)SC=N2 |
Computed by PubChem (NCBI)