CAS 1086397-96-7 is the registry number for 4-Aminothieno[2,3-b]pyridine-5-carbonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-aminothieno[2,3-b]pyridine-5-carbonitrile (CAS 1086397-96-7) is a chemical compound with the molecular formula C8H5N3S and a molecular weight of 175.21 g/mol. IUPAC name: 4-aminothieno[2,3-b]pyridine-5-carbonitrile. InChIKey: JOBACTOMUAKBAK-UHFFFAOYSA-N.
| Molecular formula | C8H5N3S |
|---|---|
| Molecular weight | 175.21 g/mol |
| IUPAC name | 4-aminothieno[2,3-b]pyridine-5-carbonitrile |
| InChIKey | JOBACTOMUAKBAK-UHFFFAOYSA-N |
| SMILES | C1=CSC2=NC=C(C(=C21)N)C#N |
Computed by PubChem (NCBI)