Products 60639-44-3
CAS 60639-44-3 is the registry number for 5-Aminothieno(3,2-b)pyridine-6-carbonitrile. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-aminothieno[3,2-b]pyridine-6-carbonitrile (CAS 60639-44-3) is a chemical compound with the molecular formula C8H5N3S and a molecular weight of 175.21 g/mol. IUPAC name: 5-aminothieno[3,2-b]pyridine-6-carbonitrile. InChIKey: VKHITFIPPGPDSB-UHFFFAOYSA-N.
| Molecular formula | C8H5N3S |
|---|---|
| Molecular weight | 175.21 g/mol |
| IUPAC name | 5-aminothieno[3,2-b]pyridine-6-carbonitrile |
| InChIKey | VKHITFIPPGPDSB-UHFFFAOYSA-N |
| SMILES | C1=CSC2=C1N=C(C(=C2)C#N)N |
Computed by PubChem (NCBI)