CAS 1101551-11-4 is the registry number for 2-Aminobenzo(D)thiazole-7-carbonitrile. Offered by: Biosynth. Available pack sizes: 100mg, 250mg, 1000mg.
2-amino-1,3-benzothiazole-7-carbonitrile (CAS 1101551-11-4) is a chemical compound with the molecular formula C8H5N3S and a molecular weight of 175.21 g/mol. IUPAC name: 2-amino-1,3-benzothiazole-7-carbonitrile. InChIKey: CIVOWQBCPVBTAH-UHFFFAOYSA-N.
| Molecular formula | C8H5N3S |
|---|---|
| Molecular weight | 175.21 g/mol |
| IUPAC name | 2-amino-1,3-benzothiazole-7-carbonitrile |
| InChIKey | CIVOWQBCPVBTAH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)N=C(S2)N)C#N |
Computed by PubChem (NCBI)