CAS 100852-80-0 appears in our catalog under these names: Diethyl 1-methyl-1h-pyrazole-3,5-dicarboxylate, 97%, Diethyl 1-methyl-1H-pyrazole-3,5-dicarboxylate 97%, Diethyl 1-methyl-1H-pyrazole-3,5-dicarboxylate, 97%, 97%, 1-Methyl-1 H -pyrazole-3,5-dicarboxylic acid diethyl ester, 97%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 100g, 10g, 25g, 1g, 5g.
Diethyl 1-methylpyrazole-3,5-dicarboxylate (CAS 100852-80-0) is a chemical compound with the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. IUPAC name: diethyl 1-methylpyrazole-3,5-dicarboxylate. InChIKey: WPKJUUKSWNCKPZ-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O4 |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | diethyl 1-methylpyrazole-3,5-dicarboxylate |
| InChIKey | WPKJUUKSWNCKPZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=NN1C)C(=O)OCC |
Computed by PubChem (NCBI)