Products 1008774-47-7

CAS 1008774-47-7 is the registry number for 2-(3-Benzyloxyphenyl)isonicotinic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

2-(3-phenylmethoxyphenyl)pyridine-4-carboxylic acid (CAS 1008774-47-7) is a chemical compound with the molecular formula C19H15NO3 and a molecular weight of 305.3 g/mol. IUPAC name: 2-(3-phenylmethoxyphenyl)pyridine-4-carboxylic acid. InChIKey: JYSKMUWENPZAGE-UHFFFAOYSA-N.

Identity
Molecular formulaC19H15NO3
Molecular weight305.3 g/mol
IUPAC name2-(3-phenylmethoxyphenyl)pyridine-4-carboxylic acid
InChIKeyJYSKMUWENPZAGE-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COC2=CC=CC(=C2)C3=NC=CC(=C3)C(=O)O

Computed by PubChem (NCBI)