CAS 22311-71-3 is the registry number for 4-[(Furan-2-yl)methylidene]-1,2,3,4-tetrahydroacridine-9-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
(4Z)-4-(furan-2-ylmethylidene)-2,3-dihydro-1H-acridine-9-carboxylic acid (CAS 22311-71-3) is a chemical compound with the molecular formula C19H15NO3 and a molecular weight of 305.3 g/mol. IUPAC name: (4Z)-4-(furan-2-ylmethylidene)-2,3-dihydro-1H-acridine-9-carboxylic acid. InChIKey: JEPMFTHJOIMUBS-QXMHVHEDSA-N.
| Molecular formula | C19H15NO3 |
|---|---|
| Molecular weight | 305.3 g/mol |
| IUPAC name | (4Z)-4-(furan-2-ylmethylidene)-2,3-dihydro-1H-acridine-9-carboxylic acid |
| InChIKey | JEPMFTHJOIMUBS-QXMHVHEDSA-N |
| SMILES | C1C/C(=C/C2=CC=CO2)/C3=NC4=CC=CC=C4C(=C3C1)C(=O)O |
Computed by PubChem (NCBI)