Products 893740-67-5
CAS 893740-67-5 appears in our catalog under these names: 5-(3-Benzyloxyphenyl)nicotinic acid, 5-(3-Benzyloxyphenyl)nicotinic acid, 98%. Offered by: TRC, Combi-blocks. Available pack sizes: 100mg, 500mg, 10g, 5g, 1g.
5-(3-phenylmethoxyphenyl)pyridine-3-carboxylic acid (CAS 893740-67-5) is a chemical compound with the molecular formula C19H15NO3 and a molecular weight of 305.3 g/mol. IUPAC name: 5-(3-phenylmethoxyphenyl)pyridine-3-carboxylic acid. InChIKey: ZGYYOXUXEQFTPJ-UHFFFAOYSA-N.
| Molecular formula | C19H15NO3 |
|---|---|
| Molecular weight | 305.3 g/mol |
| IUPAC name | 5-(3-phenylmethoxyphenyl)pyridine-3-carboxylic acid |
| InChIKey | ZGYYOXUXEQFTPJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=CC(=C2)C3=CC(=CN=C3)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
5-(3-(Benzyloxy)phenyl)nicotinic acid, 5-(3-Benzyloxyphenyl)nicotinic acid, 5-[3-(Benzyloxy)phenyl]nicotinic acid, 5-(3-phenylmethoxyphenyl)pyridine-3-carboxylic acid, 5-(3-(Benzyloxy)phenyl)nicotinicacid, 5-[3-(Benzyloxy)phenyl]pyridine-3-carboxylic acid, 5-(3-benzyloxyphenyl)pyridine-3-carboxylic acid