CAS 1373232-68-8 is the registry number for 1-(Benzyloxy)-3-(4-nitrophenyl)benzene, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-(4-nitrophenyl)-3-phenylmethoxybenzene (CAS 1373232-68-8) is a chemical compound with the molecular formula C19H15NO3 and a molecular weight of 305.3 g/mol. IUPAC name: 1-(4-nitrophenyl)-3-phenylmethoxybenzene. InChIKey: GMWNAPOOAQPPGI-UHFFFAOYSA-N.
| Molecular formula | C19H15NO3 |
|---|---|
| Molecular weight | 305.3 g/mol |
| IUPAC name | 1-(4-nitrophenyl)-3-phenylmethoxybenzene |
| InChIKey | GMWNAPOOAQPPGI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=CC(=C2)C3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)