CAS 1261892-48-1 is the registry number for 3-(4-Benzyloxyphenyl)picolinic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-(4-phenylmethoxyphenyl)pyridine-2-carboxylic acid (CAS 1261892-48-1) is a chemical compound with the molecular formula C19H15NO3 and a molecular weight of 305.3 g/mol. IUPAC name: 3-(4-phenylmethoxyphenyl)pyridine-2-carboxylic acid. InChIKey: QMPVJJDRLXMTGS-UHFFFAOYSA-N.
| Molecular formula | C19H15NO3 |
|---|---|
| Molecular weight | 305.3 g/mol |
| IUPAC name | 3-(4-phenylmethoxyphenyl)pyridine-2-carboxylic acid |
| InChIKey | QMPVJJDRLXMTGS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=C(C=C2)C3=C(N=CC=C3)C(=O)O |
Computed by PubChem (NCBI)