CAS 1009093-14-4 appears in our catalog under these names: Boc-(1r,2r)-(-)-2-amino-1-phenyl-1,3-propanediol, 95%, N-((1R,2R)-2-Hydroxy-1-(hydroxymethyl)-2-phenylethyl)carbamic Acid tert-Butyl Ester. Offered by: Combi-blocks, TRC. Available pack sizes: 250mg, 1g, 100mg.
Tert-butyl N-[(1R,2R)-1,3-dihydroxy-1-phenylpropan-2-yl]carbamate (CAS 1009093-14-4) is a chemical compound with the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. IUPAC name: tert-butyl N-[(1R,2R)-1,3-dihydroxy-1-phenylpropan-2-yl]carbamate. InChIKey: WEIHMMMBXBQYNT-VXGBXAGGSA-N.
| Molecular formula | C14H21NO4 |
|---|---|
| Molecular weight | 267.32 g/mol |
| IUPAC name | tert-butyl N-[(1R,2R)-1,3-dihydroxy-1-phenylpropan-2-yl]carbamate |
| InChIKey | WEIHMMMBXBQYNT-VXGBXAGGSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CO)[C@@H](C1=CC=CC=C1)O |
Computed by PubChem (NCBI)