CAS 135-15-9 appears in our catalog under these names: 2,5-Di-n-butoxynitrobenzene, 95%, 1,4-Dibutoxy-2-nitrobenzene, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100g, 25g, 5g.
1,4-dibutoxy-2-nitrobenzene (CAS 135-15-9) is a chemical compound with the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. IUPAC name: 1,4-dibutoxy-2-nitrobenzene. InChIKey: UVLGMZCLSQBSPZ-UHFFFAOYSA-N.
| Molecular formula | C14H21NO4 |
|---|---|
| Molecular weight | 267.32 g/mol |
| IUPAC name | 1,4-dibutoxy-2-nitrobenzene |
| InChIKey | UVLGMZCLSQBSPZ-UHFFFAOYSA-N |
| SMILES | CCCCOC1=CC(=C(C=C1)OCCCC)[N+](=O)[O-] |
Computed by PubChem (NCBI)