CAS 361380-77-0 is the registry number for 3,5-Dimethyl-1h-pyrrole-2,4-dicarboxylic acid 4-tert-butyl ester 2-ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
4-O-tert-butyl 2-O-ethyl 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate (CAS 361380-77-0) is a chemical compound with the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. IUPAC name: 4-O-tert-butyl 2-O-ethyl 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate. InChIKey: XTQZSZZJWWUQON-UHFFFAOYSA-N.
| Molecular formula | C14H21NO4 |
|---|---|
| Molecular weight | 267.32 g/mol |
| IUPAC name | 4-O-tert-butyl 2-O-ethyl 3,5-dimethyl-1H-pyrrole-2,4-dicarboxylate |
| InChIKey | XTQZSZZJWWUQON-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=C(N1)C)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)