Products 33947-97-6

CAS 33947-97-6 is the registry number for 4-(2-Hydroxy-3-isopropylamino-propoxy)-benzoic acid methyl ester, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

Methyl 4-[2-hydroxy-3-(propan-2-ylamino)propoxy]benzoate (CAS 33947-97-6) is a chemical compound with the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. IUPAC name: methyl 4-[2-hydroxy-3-(propan-2-ylamino)propoxy]benzoate. InChIKey: IKLHTJKCEKYJKI-UHFFFAOYSA-N.

Identity
Molecular formulaC14H21NO4
Molecular weight267.32 g/mol
IUPAC namemethyl 4-[2-hydroxy-3-(propan-2-ylamino)propoxy]benzoate
InChIKeyIKLHTJKCEKYJKI-UHFFFAOYSA-N
SMILESCC(C)NCC(COC1=CC=C(C=C1)C(=O)OC)O

Computed by PubChem (NCBI)