Products 613656-39-6

CAS 613656-39-6 is the registry number for Ethyl 3-amino-3-(4-ethoxy-3-methoxyphenyl)propanoate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Ethyl 3-amino-3-(4-ethoxy-3-methoxyphenyl)propanoate (CAS 613656-39-6) is a chemical compound with the molecular formula C14H21NO4 and a molecular weight of 267.32 g/mol. IUPAC name: ethyl 3-amino-3-(4-ethoxy-3-methoxyphenyl)propanoate. InChIKey: JNTCGRCDMCFMET-UHFFFAOYSA-N.

Identity
Molecular formulaC14H21NO4
Molecular weight267.32 g/mol
IUPAC nameethyl 3-amino-3-(4-ethoxy-3-methoxyphenyl)propanoate
InChIKeyJNTCGRCDMCFMET-UHFFFAOYSA-N
SMILESCCOC1=C(C=C(C=C1)C(CC(=O)OCC)N)OC

Computed by PubChem (NCBI)