Products 100914-20-3
CAS 100914-20-3 is the registry number for 6,8-Dichloroflavone. Offered by: Biosynth. Available pack sizes: 5000mg, 10000mg.
6,8-dichloro-2-phenylchromen-4-one (CAS 100914-20-3) is a chemical compound with the molecular formula C15H8Cl2O2 and a molecular weight of 291.1 g/mol. IUPAC name: 6,8-dichloro-2-phenylchromen-4-one. InChIKey: GDMGCDYCMWRPOZ-UHFFFAOYSA-N.
| Molecular formula | C15H8Cl2O2 |
|---|---|
| Molecular weight | 291.1 g/mol |
| IUPAC name | 6,8-dichloro-2-phenylchromen-4-one |
| InChIKey | GDMGCDYCMWRPOZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=O)C3=C(O2)C(=CC(=C3)Cl)Cl |
Computed by PubChem (NCBI)