Products 1009318-82-4
CAS 1009318-82-4 is the registry number for Methyl 3-(difluoromethyl)-1-methyl-1H-pyrazole-4-carboxylate, 98%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
Methyl 3-(difluoromethyl)-1-methylpyrazole-4-carboxylate (CAS 1009318-82-4) is a chemical compound with the molecular formula C7H8F2N2O2 and a molecular weight of 190.15 g/mol. IUPAC name: methyl 3-(difluoromethyl)-1-methylpyrazole-4-carboxylate. InChIKey: YJQZFIRWILVKCP-UHFFFAOYSA-N.
| Molecular formula | C7H8F2N2O2 |
|---|---|
| Molecular weight | 190.15 g/mol |
| IUPAC name | methyl 3-(difluoromethyl)-1-methylpyrazole-4-carboxylate |
| InChIKey | YJQZFIRWILVKCP-UHFFFAOYSA-N |
| SMILES | CN1C=C(C(=N1)C(F)F)C(=O)OC |
Computed by PubChem (NCBI)