Products 100935-68-0
CAS 100935-68-0 is the registry number for Dimethyl 2,3-dimethyl-1-oxo-1,2-dihydroisoquinoline-7,8-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Dimethyl 2,3-dimethyl-1-oxoisoquinoline-7,8-dicarboxylate (CAS 100935-68-0) is a chemical compound with the molecular formula C15H15NO5 and a molecular weight of 289.28 g/mol. IUPAC name: dimethyl 2,3-dimethyl-1-oxoisoquinoline-7,8-dicarboxylate. InChIKey: VUYROTXFXCRHMN-UHFFFAOYSA-N.
| Molecular formula | C15H15NO5 |
|---|---|
| Molecular weight | 289.28 g/mol |
| IUPAC name | dimethyl 2,3-dimethyl-1-oxoisoquinoline-7,8-dicarboxylate |
| InChIKey | VUYROTXFXCRHMN-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C(C=C2)C(=O)OC)C(=O)OC)C(=O)N1C |
Computed by PubChem (NCBI)