CAS 161345-77-3 appears in our catalog under these names: (2S)-2-{[(Benzyloxy)carbonyl]amino}-3-(furan-2-yl)propanoic acid, 95%, (S)-2-(((Benzyloxy)carbonyl)amino)-3-(furan-2-yl)propanoic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
(2S)-3-(furan-2-yl)-2-(phenylmethoxycarbonylamino)propanoic acid (CAS 161345-77-3) is a chemical compound with the molecular formula C15H15NO5 and a molecular weight of 289.28 g/mol. IUPAC name: (2S)-3-(furan-2-yl)-2-(phenylmethoxycarbonylamino)propanoic acid. InChIKey: JMANIBVLURMOEJ-ZDUSSCGKSA-N.
| Molecular formula | C15H15NO5 |
|---|---|
| Molecular weight | 289.28 g/mol |
| IUPAC name | (2S)-3-(furan-2-yl)-2-(phenylmethoxycarbonylamino)propanoic acid |
| InChIKey | JMANIBVLURMOEJ-ZDUSSCGKSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)N[C@@H](CC2=CC=CO2)C(=O)O |
Computed by PubChem (NCBI)