CAS 1824511-47-8 is the registry number for tert-Butyl 1,3-dioxo-5,7-dihydro-1H-furo[3,4-f]isoindole-6(3H)-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 1,3-dioxo-5,7-dihydrofuro[3,4-f]isoindole-6-carboxylate (CAS 1824511-47-8) is a chemical compound with the molecular formula C15H15NO5 and a molecular weight of 289.28 g/mol. IUPAC name: tert-butyl 1,3-dioxo-5,7-dihydrofuro[3,4-f]isoindole-6-carboxylate. InChIKey: XTPNJPRKSUESTR-UHFFFAOYSA-N.
| Molecular formula | C15H15NO5 |
|---|---|
| Molecular weight | 289.28 g/mol |
| IUPAC name | tert-butyl 1,3-dioxo-5,7-dihydrofuro[3,4-f]isoindole-6-carboxylate |
| InChIKey | XTPNJPRKSUESTR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2=CC3=C(C=C2C1)C(=O)OC3=O |
Computed by PubChem (NCBI)