Products 2469735-68-8
CAS 2469735-68-8 is the registry number for Nicardipine Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4-methyl-6-(3-nitrophenyl)-2-oxocyclohex-3-ene-1-carboxylate (CAS 2469735-68-8) is a chemical compound with the molecular formula C15H15NO5 and a molecular weight of 289.28 g/mol. IUPAC name: methyl 4-methyl-6-(3-nitrophenyl)-2-oxocyclohex-3-ene-1-carboxylate. InChIKey: VZHIQFNWPDSBHN-UHFFFAOYSA-N.
| Molecular formula | C15H15NO5 |
|---|---|
| Molecular weight | 289.28 g/mol |
| IUPAC name | methyl 4-methyl-6-(3-nitrophenyl)-2-oxocyclohex-3-ene-1-carboxylate |
| InChIKey | VZHIQFNWPDSBHN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)C(C(C1)C2=CC(=CC=C2)[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)