CAS 302953-10-2 is the registry number for Diethyl 4-oxo-1,4-dihydroquinoline-3,7-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Diethyl 4-oxo-1H-quinoline-3,7-dicarboxylate (CAS 302953-10-2) is a chemical compound with the molecular formula C15H15NO5 and a molecular weight of 289.28 g/mol. IUPAC name: diethyl 4-oxo-1H-quinoline-3,7-dicarboxylate. InChIKey: ITHPPFOLFJCUPX-UHFFFAOYSA-N.
| Molecular formula | C15H15NO5 |
|---|---|
| Molecular weight | 289.28 g/mol |
| IUPAC name | diethyl 4-oxo-1H-quinoline-3,7-dicarboxylate |
| InChIKey | ITHPPFOLFJCUPX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=C1)C(=O)C(=CN2)C(=O)OCC |
Computed by PubChem (NCBI)