Products 302953-10-2

CAS 302953-10-2 is the registry number for Diethyl 4-oxo-1,4-dihydroquinoline-3,7-dicarboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Diethyl 4-oxo-1H-quinoline-3,7-dicarboxylate (CAS 302953-10-2) is a chemical compound with the molecular formula C15H15NO5 and a molecular weight of 289.28 g/mol. IUPAC name: diethyl 4-oxo-1H-quinoline-3,7-dicarboxylate. InChIKey: ITHPPFOLFJCUPX-UHFFFAOYSA-N.

Identity
Molecular formulaC15H15NO5
Molecular weight289.28 g/mol
IUPAC namediethyl 4-oxo-1H-quinoline-3,7-dicarboxylate
InChIKeyITHPPFOLFJCUPX-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC2=C(C=C1)C(=O)C(=CN2)C(=O)OCC

Computed by PubChem (NCBI)