CAS 1009562-63-3 is the registry number for 2-[5-(Chloromethyl)-1,2,4-oxadiazol-3-yl]pyrimidine, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.
5-(chloromethyl)-3-pyrimidin-2-yl-1,2,4-oxadiazole (CAS 1009562-63-3) is a chemical compound with the molecular formula C7H5ClN4O and a molecular weight of 196.59 g/mol. IUPAC name: 5-(chloromethyl)-3-pyrimidin-2-yl-1,2,4-oxadiazole. InChIKey: XCTINNFYFNYYSO-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN4O |
|---|---|
| Molecular weight | 196.59 g/mol |
| IUPAC name | 5-(chloromethyl)-3-pyrimidin-2-yl-1,2,4-oxadiazole |
| InChIKey | XCTINNFYFNYYSO-UHFFFAOYSA-N |
| SMILES | C1=CN=C(N=C1)C2=NOC(=N2)CCl |
Computed by PubChem (NCBI)