CAS 114346-91-7 is the registry number for 2-(5-Chloromethyl-[1,2,4]oxadiazol-3-yl)-pyrazine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
5-(chloromethyl)-3-pyrazin-2-yl-1,2,4-oxadiazole (CAS 114346-91-7) is a chemical compound with the molecular formula C7H5ClN4O and a molecular weight of 196.59 g/mol. IUPAC name: 5-(chloromethyl)-3-pyrazin-2-yl-1,2,4-oxadiazole. InChIKey: KPZMMJVUGHLFHM-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN4O |
|---|---|
| Molecular weight | 196.59 g/mol |
| IUPAC name | 5-(chloromethyl)-3-pyrazin-2-yl-1,2,4-oxadiazole |
| InChIKey | KPZMMJVUGHLFHM-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=N1)C2=NOC(=N2)CCl |
Computed by PubChem (NCBI)