CAS 3589-06-8 is the registry number for 1-(4-Chlorophenyl)-4,5-dihydro-1h-1,2,3,4-tetrazol-5-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
4-(4-chlorophenyl)-1H-tetrazol-5-one (CAS 3589-06-8) is a chemical compound with the molecular formula C7H5ClN4O and a molecular weight of 196.59 g/mol. IUPAC name: 4-(4-chlorophenyl)-1H-tetrazol-5-one. InChIKey: CNEPERIPZPLFBC-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN4O |
|---|---|
| Molecular weight | 196.59 g/mol |
| IUPAC name | 4-(4-chlorophenyl)-1H-tetrazol-5-one |
| InChIKey | CNEPERIPZPLFBC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C(=O)NN=N2)Cl |
Computed by PubChem (NCBI)