CAS 897359-74-9 appears in our catalog under these names: 2-Amino-6-chloropyrido[3,2-d]pyrimidin-4(1h)-one, 95%, 2-Amino-6-chloropyrido[3,2-d]pyrimidin-4(1H)-one, 97%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 500mg.
2-amino-6-chloro-3H-pyrido[3,2-d]pyrimidin-4-one (CAS 897359-74-9) is a chemical compound with the molecular formula C7H5ClN4O and a molecular weight of 196.59 g/mol. IUPAC name: 2-amino-6-chloro-3H-pyrido[3,2-d]pyrimidin-4-one. InChIKey: QDLDKZFCEXVVSU-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN4O |
|---|---|
| Molecular weight | 196.59 g/mol |
| IUPAC name | 2-amino-6-chloro-3H-pyrido[3,2-d]pyrimidin-4-one |
| InChIKey | QDLDKZFCEXVVSU-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C1N=C(NC2=O)N)Cl |
Computed by PubChem (NCBI)