CAS 18671-92-6 appears in our catalog under these names: 3-Amino-7-chloro-1,2,4-benzotriazine-1-oxide, 95%, 3-Amino-7-chlorobenzo(e)(1,2,4)triazine 1-oxide, Triazoxide-amino. Offered by: Combi-blocks, TRC, Dr. Ehrenstorfer. Available pack sizes: 250mg, 1g, 25mg, 10mg.
7-chloro-1-oxido-1,2,4-benzotriazin-1-ium-3-amine (CAS 18671-92-6) is a chemical compound with the molecular formula C7H5ClN4O and a molecular weight of 196.59 g/mol. IUPAC name: 7-chloro-1-oxido-1,2,4-benzotriazin-1-ium-3-amine. InChIKey: OXILOAZZXVNKSG-UHFFFAOYSA-N.
| Molecular formula | C7H5ClN4O |
|---|---|
| Molecular weight | 196.59 g/mol |
| IUPAC name | 7-chloro-1-oxido-1,2,4-benzotriazin-1-ium-3-amine |
| InChIKey | OXILOAZZXVNKSG-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)[N+](=NC(=N2)N)[O-] |
Computed by PubChem (NCBI)